CymitQuimica logo

CAS 177843-30-0

:

7-Methyl-1H-benzimidazol-6-amine

Description:
7-Methyl-1H-benzimidazol-6-amine, with the CAS number 177843-30-0, is a chemical compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. This compound features a methyl group at the 7-position and an amino group at the 6-position of the benzimidazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activity, including antimicrobial and anticancer properties. Its reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-6(9)2-3-7-8(5)11-4-10-7/h2-4H,9H2,1H3,(H,10,11)
InChI key:InChIKey=RPWLPIKIULUGGV-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=C1N)N=CN2
Synonyms:
  • 1H-Benzimidazol-5-amine, 4-methyl-
  • 7-Methyl-1H-benzimidazol-6-amine
  • 1H-Benzimidazol-6-amine, 7-methyl-
Found 2 products.