CAS 1778667-08-5

B-[1-(2-Cyanoethyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(2-Cyanoethyl)-1H-pyrazol-4-yl]boronic acid is a boronic acid derivative characterized by its unique pyrazole structure, which includes a cyanoethyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity and potential for further functionalization. Additionally, the pyrazole ring contributes to its stability and may influence its biological activity. This compound is often utilized in the development of pharmaceuticals and agrochemicals due to its ability to act as a building block in the synthesis of more complex molecules. Its solubility and reactivity can vary depending on the solvent and conditions used, which is crucial for its application in chemical reactions. Overall, B-[1-(2-Cyanoethyl)-1H-pyrazol-4-yl]boronic acid is a versatile compound with significant potential in both research and industrial settings.

Formula: C₆H₈BN₃O₂

InChI: InChI=1S/C6H8BN3O2/c8-2-1-3-10-5-6(4-9-10)7(11)12/h4-5,11-12H,1,3H2

InChI key: InChIKey=HRXKAVAKMCIQFG-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CN(CCC#N)N=C1

Synonyms:

• B-[1-(2-Cyanoethyl)-1H-pyrazol-4-yl]boronic acid
• [1-(2-Cyanoethyl)-1H-pyrazol-4-yl]boronic acid
• Boronic acid, B-[1-(2-cyanoethyl)-1H-pyrazol-4-yl]-

Boronic acid, B-[1-(2-cyanoethyl)-1H-pyrazol-4-yl]-

CAS: 1778667-08-5

Formula: C₆H₈BN₃O₂

Purity: ≥98%

Molecular weight: 164.9576

Ref: IN-DA01R7PB

(1-(2-Cyanoethyl)-1H-pyrazol-4-yl)boronic acid

CAS: 1778667-08-5

Purity: ≥98%

Molecular weight: 164.9600067

Ref: 10-F612709