CAS 1778734-53-4

1H-Benzimidazole-2-methanamine, 1-methyl-5-(trifluoromethyl)-, hydrochloride (1:2)

Description:

1H-Benzimidazole-2-methanamine, 1-methyl-5-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methyl group and a trifluoromethyl group, which significantly influence its chemical properties and biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The trifluoromethyl group is known for imparting unique electronic properties, often enhancing the compound's lipophilicity and metabolic stability. As a hydrochloride salt, it typically exhibits improved stability and bioavailability compared to its free base form. This compound may be of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities would require further investigation. Overall, its structural features suggest it could interact with biological targets, making it a candidate for drug development.

Formula: C₁₀H₁₀F₃N₃·2ClH

InChI: InChI=1S/C10H10F3N3.2ClH/c1-16-8-3-2-6(10(11,12)13)4-7(8)15-9(16)5-14;;/h2-4H,5,14H2,1H3;2*1H

InChI key: InChIKey=QIBGKUJPRMUZES-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(C(F)(F)F)=CC2)N=C1CN.Cl

Synonyms:

• 1H-Benzimidazole-2-methanamine, 1-methyl-5-(trifluoromethyl)-, hydrochloride (1:2)

1-[1-methyl-5-(trifluoromethyl)-1H-1,3-benzodiazol-2-yl]methanamine dihydrochloride

CAS: 1778734-53-4

Formula: C₁₀H₁₂Cl₂F₃N₃

Purity: 95.0%

Molecular weight: 302.12

Ref: 10-F521228