
CAS 1779124-12-7
:2-Pyridinamine, 5-methoxy-N-4-piperidinyl-, hydrochloride (1:3)
Description:
2-Pyridinamine, 5-methoxy-N-4-piperidinyl-, hydrochloride (1:3) is a chemical compound characterized by its specific structural features, which include a pyridine ring and a piperidine moiety. This compound is typically classified as an amine due to the presence of the amino group (-NH2) attached to the pyridine ring. The methoxy group (-OCH3) at the 5-position of the pyridine contributes to its chemical reactivity and solubility properties. As a hydrochloride salt, it is often more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and research. The compound may exhibit biological activity, potentially influencing neurotransmitter systems or other physiological pathways, which is common for compounds containing piperidine and pyridine structures. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C11H17N3O·3ClH
InChI:InChI=1S/C11H17N3O.3ClH/c1-15-10-2-3-11(13-8-10)14-9-4-6-12-7-5-9;;;/h2-3,8-9,12H,4-7H2,1H3,(H,13,14);3*1H
InChI key:InChIKey=LVYQLSBZXMNLPQ-UHFFFAOYSA-N
SMILES:N(C1=CC=C(OC)C=N1)C2CCNCC2.Cl
Synonyms:- 2-Pyridinamine, 5-methoxy-N-4-piperidinyl-, hydrochloride (1:3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methoxy-N-(piperidin-4-yl)pyridin-2-amine trihydrochloride
CAS:Formula:C11H20Cl3N3OMolecular weight:316.65
