CAS 1779124-33-2

1-Methoxy-2-(propylthio)benzene

Description:

1-Methoxy-2-(propylthio)benzene, also known by its CAS number 1779124-33-2, is an organic compound characterized by the presence of a methoxy group (-OCH3) and a propylthio group (-S(CH2)2CH3) attached to a benzene ring. This compound features a substituted aromatic structure, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The methoxy group is known to enhance the solubility of the compound in organic solvents, while the propylthio group can influence its electronic properties and steric hindrance. The presence of sulfur in the propylthio group may also impart unique characteristics, such as increased nucleophilicity or potential for coordination with metal ions. Overall, the combination of these functional groups makes 1-Methoxy-2-(propylthio)benzene a compound of interest for further study in synthetic chemistry and its potential utility in various chemical applications.

Formula: C₁₀H₁₄OS

InChI: InChI=1S/C10H14OS/c1-3-8-12-10-7-5-4-6-9(10)11-2/h4-7H,3,8H2,1-2H3

InChI key: InChIKey=VCSXGOFEROODCE-UHFFFAOYSA-N

SMILES: S(CCC)C1=C(OC)C=CC=C1

Synonyms:

• 1-Methoxy-2-(propylthio)benzene
• 2-Methoxyphenyl 1-propylsulfide
• Benzene, 1-methoxy-2-(propylthio)-
• 1-methoxy-2-propylsulfanylbenzene
• (2-methoxyphenyl)(propyl)sulfane

(2-Methoxyphenyl) propyl sulfide

CAS: 1779124-33-2

Formula: C₁₀H₁₄OS

Molecular weight: 182.28

Ref: 10-F094827