CAS 17793-95-2
:rel-(1R,2S)-3,5-Cyclohexadiene-1,2-diol
Description:
Rel-(1R,2S)-3,5-Cyclohexadiene-1,2-diol is an organic compound characterized by its bicyclic structure, which features a cyclohexadiene framework with hydroxyl (-OH) groups at the 1 and 2 positions. This compound exhibits chirality due to the presence of stereocenters, leading to specific optical activity. The presence of double bonds in the cyclohexadiene structure contributes to its reactivity, making it a potential candidate for various chemical transformations, including oxidation and substitution reactions. The hydroxyl groups enhance its solubility in polar solvents and can participate in hydrogen bonding, influencing its physical properties such as boiling and melting points. Additionally, the compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its CAS number, 17793-95-2, allows for easy identification in chemical databases and literature. Overall, rel-(1R,2S)-3,5-Cyclohexadiene-1,2-diol is a versatile compound with unique structural and chemical properties that can be explored for various applications in organic synthesis and pharmaceuticals.
Formula:C6H8O2
InChI:InChI=1/C6H8O2/c7-5-3-1-2-4-6(5)8/h1-8H/t5-,6+
InChI key:InChIKey=YDRSQRPHLBEPTP-OLQVQODUNA-N
SMILES:O[C@H]1[C@@H](O)C=CC=C1
Synonyms:- cis-3,5-Cyclohexadiene-1,2-diol
- 3,5-Cyclohexadiene-1,2-diol, (1R,2S)-rel-
- 3,5-Cyclohexadiene-1,2-diol, cis-
- cis-1,2-Dihydroxycyclohexa-3,5-diene
- rel-(1R,2S)-3,5-Cyclohexadiene-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
