CAS 177931-17-8: sauchinone
Description:Sauchinone is a naturally occurring chemical compound classified as a sesquiterpene, primarily derived from the plant species *Saururus cernuus*, commonly known as lizard tail. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties. Sauchinone exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer effects, making it a subject of interest in pharmacological research. The compound is typically found in the form of a colorless to pale yellow liquid and has a distinctive odor. Its solubility varies, being more soluble in organic solvents than in water. The molecular formula of sauchinone reflects its composition of carbon, hydrogen, and oxygen atoms, which is typical for sesquiterpenes. Due to its bioactive properties, sauchinone is being explored for various therapeutic applications, although further studies are needed to fully understand its mechanisms of action and potential uses in medicine.
Formula:C20H20O6
InChI:InChI=1S/C20H20O6/c1-9-3-11-13(21)5-17-20(25-8-24-17)19(11)18(10(9)2)12-4-15-16(23-7-22-15)6-14(12)26-20/h4-6,9-11,18-19H,3,7-8H2,1-2H3/t9-,10+,11+,18+,19+,20+/m1/s1
InChI key:InChIKey=GMTJIWUFFXGFHH-WPAOEJHSSA-N
SMILES:O=C1C=C2OCOC32OC4=CC=5OCOC5C=C4C6C(C)C(C)CC1C63
- Synonyms:
- (5aR,7R,8S,8aR,14aS,14bR)-5a,6,7,8,8a,14b-Hexahydro-7,8-dimethyl-5H-benzo[kl]bis[1,3]dioxolo[4,5-b:4′,5′-g]xanthen-5-one
- (5aR,7R,8S,8aR,14aS,14bR)-7,8-dimethyl-5a,6,7,8,8a,14b-hexahydro-5H-benzo[kl]bis[1,3]dioxolo[4,5-b:4',5'-g]xanthen-5-one
- 5H-Benzo[kl]bis[1,3]dioxolo[4,5-b:4′,5′-g]xanthen-5-one, 5a,6,7,8,8a,14b-hexahydro-7,8-dimethyl-, (5aR,7R,8S,8aR,14aS,14bR)-
- 5H-Benzo[kl]bis[1,3]dioxolo[4,5-b:4′,5′-g]xanthen-5-one, 5a,6,7,8,8a,14b-hexahydro-7,8-dimethyl-, (5aα,7α,8β,8aβ,14aS*,14bβ)-
- 5H-benzo[kl][1,3]dioxolo[4,5-b]-1,3-dioxolo[4,5-g]xanthen-5-one, 5a,6,7,8,8a,14b-hexahydro-7,8-dimethyl-, (5aR,7R,8S,8aR,14aS,14bR)-
