CymitQuimica logo

CAS 177948-33-3

:

4-Piperidineacetic acid, a-amino-1-[(1,1-dimethylethoxy)carbonyl]-,methyl ester

Description:
4-Piperidineacetic acid, α-amino-1-[(1,1-dimethylethoxy)carbonyl]-, methyl ester, identified by CAS number 177948-33-3, is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. This compound features an α-amino acid structure, indicating the presence of both an amino group and a carboxylic acid group, which are key functional groups in biochemistry. The dimethylethoxycarbonyl group serves as a protective moiety, enhancing the compound's stability and solubility in organic solvents. As a methyl ester, it exhibits properties typical of esters, such as volatility and reactivity in hydrolysis reactions. The presence of the piperidine ring may also impart unique pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, particularly in the synthesis of bioactive molecules.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-13(2,3)19-12(17)15-7-5-9(6-8-15)10(14)11(16)18-4/h9-10H,5-8,14H2,1-4H3
InChI key:KCWQYYUIIOHOLI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)C(C(=O)OC)N
Found 2 products.