CAS 177957-48-1

2-[(4-Fluorobenzoyl)amino]-4-thiazoleacetic acid

Description:

2-[(4-Fluorobenzoyl)amino]-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and an acetic acid moiety. The presence of a fluorobenzoyl group enhances its potential for biological activity, making it of interest in pharmaceutical research. This compound typically exhibits moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions in its structure. Its molecular structure suggests potential interactions with biological targets, which may include enzyme inhibition or receptor binding. The thiazole ring contributes to its stability and reactivity, while the acetic acid functional group may influence its acid-base properties. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability. Overall, 2-[(4-Fluorobenzoyl)amino]-4-thiazoleacetic acid is a compound of interest in medicinal chemistry, particularly for its potential applications in drug development and therapeutic interventions.

Formula: C₁₂H₉FN₂O₃S

InChI: InChI=1S/C12H9FN2O3S/c13-8-3-1-7(2-4-8)11(18)15-12-14-9(6-19-12)5-10(16)17/h1-4,6H,5H2,(H,16,17)(H,14,15,18)

InChI key: InChIKey=RWRXBHULELHWBH-UHFFFAOYSA-N

SMILES: C(NC1=NC(CC(O)=O)=CS1)(=O)C2=CC=C(F)C=C2

Synonyms:

• 4-Thiazoleacetic acid, 2-[(4-fluorobenzoyl)amino]-
• 2-[2-[(4-Fluorobenzoyl)amino]-1,3-thiazol-4-yl]acetic acid
• 2-[(4-Fluorobenzoyl)amino]-4-thiazoleacetic acid
• 2-[2-(4-Fluorobenzamido)-1,3-thiazol-4-yl]acetic acid

{2-[(4-fluorobenzoyl)amino]-1,3-thiazol-4-yl}acetic acid

CAS: 177957-48-1

Formula: C₁₂H₉FN₂O₃S

Purity: 95.0%

Molecular weight: 280.27

Ref: 10-F520766