CAS 17796-61-1

4-Acetyl-2-piperazinone

Description:

4-Acetyl-2-piperazinone, with the CAS number 17796-61-1, is a chemical compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features an acetyl group attached to the piperazinone moiety, contributing to its reactivity and potential applications in medicinal chemistry. It is typically a white to off-white crystalline solid, soluble in polar organic solvents, and exhibits moderate stability under standard conditions. The presence of the acetyl group enhances its ability to participate in various chemical reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 4-acetyl-2-piperazinone may exhibit biological activity, which has been the subject of research in the context of drug development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions, making it essential to consult specific literature for detailed information regarding its behavior in various applications.

Formula: C₆H₁₀N₂O₂

InChI: InChI=1S/C6H10N2O2/c1-5(9)8-3-2-7-6(10)4-8/h2-4H2,1H3,(H,7,10)

InChI key: InChIKey=ISNPMTVERREURB-UHFFFAOYSA-N

SMILES: C(C)(=O)N1CC(=O)NCC1

Synonyms:

• 4-Acetyl-2-oxopiperazine
• 1-Acetyl-3-oxopiperazine
• Piperazinone, 4-acetyl-
• 2-Piperazinone, 4-acetyl-
• 4-Acetyl-2-piperazinone

2-Piperazinone, 4-acetyl-

CAS: 17796-61-1

Formula: C₆H₁₀N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1558

Ref: IN-DA0025NV

4-acetylpiperazin-2-one

CAS: 17796-61-1

Formula: C₆H₁₀N₂O₂

Purity: 97%

Molecular weight: 142.158

Ref: 10-F517141