CAS 177976-33-9
:3-(chloromethyl)-5-(4-fluorophenyl)pyridine
Description:
3-(Chloromethyl)-5-(4-fluorophenyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The compound features a chloromethyl group (-CH2Cl) at the 3-position and a para-fluorophenyl group at the 5-position of the pyridine ring, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the chlorine atom makes it a suitable candidate for nucleophilic substitution reactions, while the fluorine atom can enhance lipophilicity and influence biological activity. This compound may exhibit interesting pharmacological properties, making it relevant in the development of pharmaceuticals or agrochemicals. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with tailored properties. As with many halogenated compounds, considerations regarding its environmental impact and safety profile are essential in its handling and application.
Formula:C12H9ClFN
InChI:InChI=1/C12H9ClFN/c13-6-9-5-11(8-15-7-9)10-1-3-12(14)4-2-10/h1-5,7-8H,6H2
SMILES:c1cc(ccc1c1cc(CCl)cnc1)F
Synonyms:- Pyridine, 3-(Chloromethyl)-5-(4-Fluorophenyl)-
- 3-(Chloromethyl)-5-(4-fluorophenyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
