CAS 177976-49-7

3-PHENYLBENZYLAMINE

Description:

3-Phenylbenzylamine, with the CAS number 177976-49-7, is an organic compound characterized by the presence of both phenyl and benzyl functional groups attached to an amine. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It features a primary amine functional group, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of various derivatives and intermediates. The presence of multiple aromatic rings in its structure enhances its stability and may influence its solubility in organic solvents. Additionally, 3-phenylbenzylamine may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific formulation and environmental conditions. As with many amines, it may also engage in hydrogen bonding, affecting its interactions with other chemical species. Safety precautions should be observed when handling this compound due to potential toxicity and reactivity.

Formula: C₁₃H₁₃N

InChI: InChI=1/C13H13N/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10,14H2

SMILES: c1ccc(cc1)c1cccc(c1)CN

Synonyms:

• Rarechem Al Bw 0885
• Timtec-Bb Sbb007527
• 1-Biphenyl-3-Ylmethanamine
• Biphenyl-3-methanamine

[1,1'-Biphenyl]-3-methanamine

CAS: 177976-49-7

Formula: C₁₃H₁₃N

Purity: 98%

Color and Shape: Solid

Molecular weight: 183.2490

Ref: IN-DA0025P8

3-(Aminomethyl)biphenyl

CAS: 177976-49-7

3-(Aminomethyl)biphenyl

Formula: C₁₃H₁₃N

Purity: 98%

Color and Shape: Low-Melting Solid

Molecular weight: 183.25g/mol

Ref: 54-OR8815

3-Phenylbenzyl amine

CAS: 177976-49-7

Formula: C₁₃H₁₃N

Purity: 98%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 183.254

Ref: 10-F009340