CAS 1780-36-5
:Pyrimidine, 2,4,6-trichloro-5-methyl-
Description:
Pyrimidine, 2,4,6-trichloro-5-methyl- is a chlorinated derivative of pyrimidine, a six-membered aromatic heterocyclic compound containing nitrogen atoms. This specific compound features three chlorine atoms substituted at the 2, 4, and 6 positions, along with a methyl group at the 5 position. Its molecular structure contributes to its unique chemical properties, including increased reactivity due to the presence of electronegative chlorine atoms. The compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its applications in various fields, including pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. Due to the presence of chlorine, it may exhibit significant biological activity, but it also requires careful handling due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this compound, including the use of personal protective equipment and adherence to regulatory guidelines.
Formula:C6H13NO
InChI:InChI=1/C6H13NO/c7-5-2-1-3-6(8)4-5/h5-6,8H,1-4,7H2
SMILES:C1CC(CC(C1)O)N
Synonyms:- 2,4,6-Trichloro-5-methylpyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,6-Trichloro-5-methylpyrimidine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H3Cl3N2Purity:98%Molecular weight:197.44Pyrimidine, 2,4,6-trichloro-5-methyl-
CAS:Formula:C5H3Cl3N2Purity:98%Color and Shape:SolidMolecular weight:197.44975-Methyl-2,4,6-trichloropyrimidine
CAS:5-Methyl-2,4,6-trichloropyrimidineFormula:C5H3Cl3N2Purity:98%Color and Shape: off-white solidMolecular weight:197.45g/mol2,4,6-Trichloro-5-methylpyrimidine
CAS:2,4,6-Trichloro-5-methylpyrimidine is a nucleoside for use in research applicationsFormula:C5H3Cl3N2Purity:Min. 95%Color and Shape:PowderMolecular weight:197.45 g/mol2,4,6-Trichloro-5-methylpyrimidine
CAS:Formula:C5H3Cl3N2Purity:98%Color and Shape:Brown powderMolecular weight:197.44




