CAS 17808-06-9
:5-Diazo-4-oxo-L-norvaline
Description:
5-Diazo-4-oxo-L-norvaline, with the CAS number 17808-06-9, is an organic compound that belongs to the class of amino acids and is characterized by the presence of a diazo group and a ketone functional group. This compound is a derivative of L-norvaline, which is an amino acid that plays a role in protein synthesis. The diazo group contributes to its reactivity, making it useful in various chemical reactions, including those in organic synthesis and medicinal chemistry. The presence of the ketone group indicates potential for tautomerization and reactivity in nucleophilic addition reactions. 5-Diazo-4-oxo-L-norvaline may exhibit biological activity, which has been explored in research contexts, particularly in relation to its potential as an inhibitor of certain enzymes. Its solubility and stability can vary depending on the conditions, such as pH and solvent used. Overall, this compound is of interest in both synthetic and biological chemistry due to its unique structural features and potential applications.
Formula:C5H7N3O3
InChI:InChI=1S/C5H7N3O3/c6-4(5(10)11)1-3(9)2-8-7/h2,4H,1,6H2,(H,10,11)/t4-/m0/s1
InChI key:InChIKey=FMHPSVZSLZOGKT-BYPYZUCNSA-N
SMILES:C(C[C@@H](C(O)=O)N)(C=[N+]=[N-])=O
Synonyms:- L-5-Diazo-4-oxonorvaline
- 5-diazen-1-iumylidene-4-oxonorvaline
- NSC 117613
- DONV
- 5-Diazo-4-oxo-L-norvaline
- 5-Diazo-4-oxonorvaline
- L-Norvaline, 5-diazo-4-oxo-
- NSC 117613
- 5-Diazo-4-oxo-L-norvaline
- 2-Amino-5-diazolevulinic acid
- L-Norvaline, 5-diazo-4-oxo-
- (1Z,4S)-4-amino-4-carboxy-1-diazoniobut-1-en-2-olate
- Levulinic acid, 2-amino-5-diazo-, L-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
