CAS 1781241-38-0
:1,1-Dimethylethyl 4-[[3-(4-methoxyphenyl)-2-oxo-5-oxazolidinyl]methyl]-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-[[3-(4-methoxyphenyl)-2-oxo-5-oxazolidinyl]methyl]-1-piperazinecarboxylate, with the CAS number 1781241-38-0, is a chemical compound characterized by its complex structure, which includes a piperazine ring, an oxazolidinone moiety, and a methoxyphenyl group. This compound is likely to exhibit properties typical of piperazine derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the methoxy group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the oxazolidinone structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability, reactivity, and interaction with biological targets would depend on its specific functional groups and stereochemistry. As with many synthetic organic compounds, safety data, including toxicity and environmental impact, would be essential for its handling and application in research or industry. Further studies would be necessary to fully elucidate its characteristics and potential uses.
Formula:C20H29N3O5
InChI:InChI=1S/C20H29N3O5/c1-20(2,3)28-18(24)22-11-9-21(10-12-22)13-17-14-23(19(25)27-17)15-5-7-16(26-4)8-6-15/h5-8,17H,9-14H2,1-4H3
InChI key:InChIKey=UTXVGVTZQUIFHB-UHFFFAOYSA-N
SMILES:O=C1N(CC(CN2CCN(C(OC(C)(C)C)=O)CC2)O1)C3=CC=C(OC)C=C3
Synonyms:- 1-Piperazinecarboxylic acid, 4-[[3-(4-methoxyphenyl)-2-oxo-5-oxazolidinyl]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-[[3-(4-methoxyphenyl)-2-oxo-5-oxazolidinyl]methyl]-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-{[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl}piperazine-1-carboxylate
CAS:tert-Butyl 4-{[3-(4-methoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl}piperazine-1-carboxylate
Molecular weight:391.46g/mol
