CymitQuimica logo

CAS 178161-06-3

:

2,7-BIS(TERT-BUTYLDIMETHYLSILANYLOXY)NAPHTHALENE

Description:
2,7-Bis(tert-butyldimethylsilyloxy)naphthalene is an organosilicon compound characterized by the presence of two tert-butyldimethylsilyloxy groups attached to the naphthalene core at the 2 and 7 positions. This compound typically exhibits hydrophobic properties due to the bulky tert-butyldimethylsilyl groups, which can enhance its solubility in organic solvents while making it less soluble in water. The presence of the silyloxy groups can also provide increased thermal stability and resistance to oxidation. Additionally, the naphthalene structure contributes to its potential applications in organic synthesis and materials science, particularly in the development of functionalized polymers or as intermediates in chemical reactions. The compound may also exhibit interesting electronic properties due to the conjugated naphthalene system, which can be relevant in the design of electronic materials. Overall, 2,7-bis(tert-butyldimethylsilyloxy)naphthalene is a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C22H36O2Si2
InChI:InChI=1/C22H36O2Si2/c1-21(2,3)25(7,8)23-19-13-11-17-12-14-20(16-18(17)15-19)24-26(9,10)22(4,5)6/h11-16H,1-10H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc2ccc(cc2c1)O[Si](C)(C)C(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.