CymitQuimica logo

CAS 178165-43-0

:

6-{3-[4-(4-fluorobenzyl)piperidin-1-yl]propanoyl}-1,3-benzoxazol-2(3H)-one

Description:
The chemical substance known as 6-{3-[4-(4-fluorobenzyl)piperidin-1-yl]propanoyl}-1,3-benzoxazol-2(3H)-one, with the CAS number 178165-43-0, is a synthetic organic compound characterized by its complex structure, which includes a benzoxazole core and a piperidine moiety. This compound features a fluorobenzyl group, which contributes to its lipophilicity and potential biological activity. The presence of the benzoxazole ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as benzoxazoles are known for their diverse biological properties. The compound's molecular structure indicates it may interact with various biological targets, making it of interest in drug discovery. Additionally, its specific functional groups may influence its solubility, stability, and reactivity, which are critical factors in determining its efficacy and safety in potential therapeutic applications. Overall, this compound exemplifies the intricate design often found in modern medicinal chemistry aimed at optimizing pharmacological profiles.
Formula:C22H23FN2O3
InChI:InChI=1/C22H23FN2O3/c23-18-4-1-15(2-5-18)13-16-7-10-25(11-8-16)12-9-20(26)17-3-6-19-21(14-17)28-22(27)24-19/h1-6,14,16H,7-13H2,(H,24,27)
Synonyms:
  • 3-[4-(4-fluorobenzyl)piperidin-1-yl]-1-(2-hydroxy-1,3-benzoxazol-6-yl)propan-1-one
  • 1-propanone, 3-[4-[(4-fluorophenyl)methyl]-1-piperidinyl]-1-(2-hydroxy-6-benzoxazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.