CAS 17817-88-8
:(R)-(-)-Mevalonic acid
Description:
(R)-(-)-Mevalonic acid is a naturally occurring organic compound that plays a crucial role in the biosynthesis of terpenes and sterols. It is a chiral molecule, meaning it has two enantiomers, with the (R)-(-) form being the biologically active one. This compound is a key intermediate in the mevalonate pathway, which is essential for the synthesis of cholesterol and other important biomolecules. Mevalonic acid is characterized by its carboxylic acid functional group, which contributes to its solubility in water and its ability to participate in various biochemical reactions. The presence of multiple hydroxyl groups also enhances its reactivity and interaction with other molecules. In terms of physical properties, it is typically a colorless to pale yellow liquid or solid, depending on its state. Its CAS number, 17817-88-8, is used for identification in chemical databases. Overall, (R)-(-)-Mevalonic acid is significant in both biological systems and industrial applications, particularly in the synthesis of pharmaceuticals and bioactive compounds.
Formula:C6H12O4
InChI:InChI=1S/C6H12O4/c1-6(10,2-3-7)4-5(8)9/h7,10H,2-4H2,1H3,(H,8,9)/t6-/m1/s1
InChI key:InChIKey=KJTLQQUUPVSXIM-ZCFIWIBFSA-N
SMILES:C([C@](CCO)(C)O)C(O)=O
Synonyms:- (3R)-3,5-Dihydroxy-3-methylpentanoic acid
- Pentanoic acid, 3,5-dihydroxy-3-methyl-, (R)-
- Pentanoic acid, 3,5-dihydroxy-3-methyl-, (3R)-
- Valeric acid, 3,5-dihydroxy-3-methyl-, (R)-
- (3R)-Mevalonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

