CAS 1782-55-4
:5-hydroxyferulic acid
Description:
5-Hydroxyferulic acid is a phenolic compound that belongs to the class of hydroxycinnamic acids, which are widely distributed in the plant kingdom. It is characterized by a hydroxyl group (-OH) attached to the fifth carbon of the ferulic acid structure, which contributes to its antioxidant properties. This compound is known for its potential health benefits, including anti-inflammatory, anti-cancer, and neuroprotective effects, making it of interest in both nutritional and pharmaceutical research. 5-Hydroxyferulic acid is soluble in water and organic solvents, which facilitates its extraction from various plant sources. Its chemical structure allows it to participate in various biochemical reactions, including those involving free radicals, thereby playing a role in cellular protection. Additionally, it may contribute to the flavor and aroma profiles of certain foods, particularly in the context of plant-based diets. Overall, 5-hydroxyferulic acid is a compound of significant interest due to its bioactive properties and potential applications in health and nutrition.
Formula:C10H10O5
InChI:InChI=1/C10H10O5/c1-15-8-5-6(2-3-9(12)13)4-7(11)10(8)14/h2-5,11,14H,1H3,(H,12,13)/b3-2+
InChI key:InChIKey=YFXWTVLDSKSYLW-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC(OC)=C(O)C(O)=C1
Synonyms:- (2E)-3-(3,4-dihydroxy-5-methoxyphenyl)prop-2-enoic acid
- 2-Propenoic acid, 3-(3,4-dihydroxy-5-methoxyphenyl)-
- 3,4-Dihydroxy-5-methoxycinnamic acid
- 3-(3,4-Dihydroxy-5-methoxyphenyl)-2-propenoic acid
- Cinnamic acid, 3,4-dihydroxy-5-methoxy-
- 5-Hydroxyferulic acid
- 3-Methoxycaffeic acid
- 3,4-Dihydroxy-5-methoxycinnamic acid >=95.0% (HPLC)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3,4-Dihydroxy-5-methoxycinnamic acid
CAS:3,4-Dihydroxy-5-methoxycinnamic acid is a phenolic compound that has been isolated from the rhizome of Cimicifuga. It is an inhibitor of cancer cells and is effective against cervical cancer. 3,4-Dihydroxy-5-methoxycinnamic acid inhibits the growth of tumor cells in vitro and also shows significant cytotoxicity against tumor tissues in vivo. The inhibitory effects are related to the ability to bind to enzymes such as protocatechuic acid hydroxylase (PCA) and caffeic acid O-methyltransferase (COMT), which are the target enzymes for this compound. 3,4-Dihydroxy-5-methoxycinnamic acid is metabolized by protocatechuic acid 4-hydroxylase (PCAH) and caffeic acid 4-hydroxylase (CAH), which converts it into protocatechuFormula:C10H10O5Purity:Min. 95%Molecular weight:210.18 g/mol


