CAS 17820-07-4
:nordentatin
Description:
Nordentatin, with the CAS number 17820-07-4, is a naturally occurring alkaloid primarily derived from certain plant species, particularly those in the family Apocynaceae. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Nordentatin has garnered interest in pharmacology due to its potential therapeutic properties, including anti-inflammatory and anti-cancer effects. Its mechanism of action often involves interaction with various biological targets, which may lead to modulation of cellular pathways. Additionally, nordentatin exhibits solubility in organic solvents, which is typical for many alkaloids, but its solubility in water is limited. The compound's stability can be influenced by environmental factors such as pH and temperature. Research into nordentatin continues to explore its efficacy and safety profile, making it a subject of interest in medicinal chemistry and natural product research.
Formula:C19H20O4
InChI:InChI=1/C19H20O4/c1-6-18(2,3)14-16-11(7-8-13(20)22-16)15(21)12-9-10-19(4,5)23-17(12)14/h6-10,21H,1H2,2-5H3
SMILES:C=CC(C)(C)c1c2c(ccc(=O)o2)c(c2C=CC(C)(C)Oc12)O
Synonyms:- 2H,8H-Benzo(1,2-b:3,4-b')dipyran-8-one, 6-(1,1-dimethyl-2-propenyl)-5-hydroxy-2,2-dimethyl-
- 6-(1,1-dimethylprop-2-en-1-yl)-5-hydroxy-2,2-dimethyl-2H,8H-pyrano[2,3-f]chromen-8-one
- 10-(1,1-dimethylprop-2-en-1-yl)-5-hydroxy-8,8-dimethyl-2H,8H-pyrano[3,2-g]chromen-2-one
- Nordentatin
- 2H,8H-Benzo[1,2-b:3,4-b']dipyran-8-one, 6-(1,1-dimethyl-2-propen-1-yl)-5-hydroxy-2,2-dimethyl-
- Nordentatin >=95% (LC/MS-ELSD)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Nordentatin
CAS:Nordentatin is a useful organic compound for research related to life sciences. The catalog number is T125555 and the CAS number is 17820-07-4.Formula:C19H20O4Color and Shape:SolidMolecular weight:312.365

