CAS 17823-46-0
:4-BROMO-2,3,5,6-TETRAFLUOROBENZOTRIFLUORIDE
Description:
4-Bromo-2,3,5,6-tetrafluorobenzotrifluoride is a halogenated aromatic compound characterized by the presence of both bromine and multiple fluorine substituents on a benzene ring. This compound features a bromine atom at the para position relative to a trifluoromethyl group, along with four fluorine atoms at the ortho and meta positions. Its molecular structure contributes to its unique chemical properties, including high thermal stability and reactivity due to the electronegative nature of the fluorine atoms. The presence of these halogens can significantly influence the compound's polarity, solubility, and potential applications in various fields, such as pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit specific behaviors in terms of reactivity, such as participating in electrophilic aromatic substitution reactions or serving as a precursor in the synthesis of more complex fluorinated compounds. Safety precautions should be taken when handling this substance, as halogenated compounds can pose environmental and health risks.
Formula:C7BrF7
InChI:InChI=1/C7BrF7/c8-2-5(11)3(9)1(7(13,14)15)4(10)6(2)12
SMILES:c1(c(c(c(c(c1F)F)Br)F)F)C(F)(F)F
Synonyms:- 4-Trifluoromethyl-2,3,5,6-Tetrafluorobromobenzene
- 4-Bromo-Alpha,Alpha,Alpha,2,3,5,6-Heptafluorotoluene
- 4-Bromoheptafluorotoluene
- 4-Bromoperfluorotoluene
- 1-Bromo-2,3,5,6-Tetrafluoro-4-(Trifluoromethyl)Benzene
- 4-Bromo-2,3,5,6-tetrafluorobenzotrifluoride 97%
- 4-Bromo-2,3,5,6-tetrafluorobenzotrifluoride97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Trifluoromethyl-2,3,5,6-tetrafluorobromobenzene
CAS:Formula:C7BrF7Purity:>99.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:296.974-Bromo-2,3,5,6-tetrafluorobenzotrifluoride, 99%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7BrF7Purity:99%Color and Shape:Clear colorless, LiquidMolecular weight:296.97Benzene, 1-bromo-2,3,5,6-tetrafluoro-4-(trifluoromethyl)-
CAS:Formula:C7BrF7Purity:95%Color and Shape:LiquidMolecular weight:296.96774-Bromoperfluorotoluene
CAS:4-BromoperfluorotolueneFormula:C7BrF7Purity:99%Color and Shape: clear liquidMolecular weight:296.97g/mol4-Bromo-2,3,5,6-tetrafluorobenzotrifluoride
CAS:Formula:C7BrF7Purity:97.0%Color and Shape:Liquid, ClearMolecular weight:296.97




