CymitQuimica logo

CAS 17825-44-4

:

6-methoxy-3-oxo-2,3-dihydro-1H-indene-1-carboxylic acid

Description:
6-Methoxy-3-oxo-2,3-dihydro-1H-indene-1-carboxylic acid, with the CAS number 17825-44-4, is an organic compound characterized by its indene structure, which features a fused ring system. This compound contains a methoxy group (-OCH3) and a carboxylic acid group (-COOH), contributing to its reactivity and potential applications in organic synthesis. The presence of the keto group (C=O) enhances its electrophilic character, making it useful in various chemical reactions, including condensation and substitution reactions. The dihydroindene framework provides a degree of stability while allowing for functionalization at specific positions on the ring. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and reactivity can vary depending on the solvent and conditions, which is important for its practical applications. Overall, 6-methoxy-3-oxo-2,3-dihydro-1H-indene-1-carboxylic acid is a versatile compound with potential uses in various fields of chemistry.
Formula:C11H10O4
InChI:InChI=1/C11H10O4/c1-15-6-2-3-7-8(4-6)9(11(13)14)5-10(7)12/h2-4,9H,5H2,1H3,(H,13,14)
SMILES:COc1ccc2c(c1)C(CC2=O)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.