CAS 17825-58-0
:2,3-diphenylcycloprop-2-ene-1-carboxylic acid
Description:
2,3-Diphenylcycloprop-2-ene-1-carboxylic acid is an organic compound characterized by its unique cyclopropene structure, which features a three-membered carbon ring with two phenyl groups attached to the cyclopropene framework. This compound contains a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the phenyl groups enhances its stability and may influence its electronic properties, making it an interesting candidate for various chemical reactions, including electrophilic substitutions and cycloadditions. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its structural features suggest potential applications in organic synthesis, materials science, and medicinal chemistry. Additionally, the compound's unique geometry and functional groups may lead to interesting interactions in biological systems, although specific biological activity would require further investigation. Overall, 2,3-diphenylcycloprop-2-ene-1-carboxylic acid represents a fascinating example of cyclopropene chemistry with potential implications in various fields of research.
Formula:C16H12O2
InChI:InChI=1/C16H12O2/c17-16(18)15-13(11-7-3-1-4-8-11)14(15)12-9-5-2-6-10-12/h1-10,15H,(H,17,18)
InChI key:LRFRUFJNOGIAFA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1=C(c2ccccc2)C1C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Diphenylcycloprop-2-ene-1-carboxylic acid
CAS:Formula:C16H12O2Color and Shape:SolidMolecular weight:236.2653
