CAS 17826-05-0

5,6-Dibromoisatin

Description:

5,6-Dibromoisatin is a chemical compound that belongs to the class of isatin derivatives, characterized by the presence of bromine substituents at the 5 and 6 positions of the isatin structure. It is typically represented by the molecular formula C8H4Br2N2O and has a molecular weight that reflects its halogenated nature. This compound exhibits a range of interesting chemical properties, including its ability to participate in various chemical reactions due to the presence of the carbonyl and nitrogen functional groups. 5,6-Dibromoisatin is often studied for its potential biological activities, including antimicrobial and anticancer properties, making it of interest in medicinal chemistry. Its solubility can vary depending on the solvent, and it may exhibit distinct spectral characteristics in techniques such as NMR and IR spectroscopy. Additionally, the presence of bromine atoms can influence its reactivity and interaction with other chemical species, making it a valuable compound for synthetic applications and research in organic chemistry.

Formula: C₈H₃Br₂NO₂

InChI: InChI=1S/C8H3Br2NO2/c9-4-1-3-6(2-5(4)10)11-8(13)7(3)12/h1-2H,(H,11,12,13)

InChI key: InChIKey=BHIYOAMJNNOSLP-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC1=O)=CC(Br)=C(Br)C2

Synonyms:

• 5,6-Dibromo-1H-indole-2,3-dione
• Indole-2,3-dione, 5,6-dibromo-
• 5,6-Dibromoisatin
• 1H-Indole-2,3-dione, 5,6-dibromo-

1H-Indole-2,3-dione, 5,6-dibromo-

CAS: 17826-05-0

Formula: C₈H₃Br₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 304.9229

Ref: IN-DA0025W8

5,6-Dibromoindoline-2,3-dione

CAS: 17826-05-0

5,6-Dibromoindoline-2,3-dione

Purity: 95%

Molecular weight: 304.92g/mol

Ref: 54-OR95095

5,6-Dibromoindoline-2,3-dione

CAS: 17826-05-0

Formula: C₈H₃Br₂NO₂

Purity: 95%

Molecular weight: 304.925

Ref: 10-F220703

5,6-Dibromoindoline-2,3-dione

CAS: 17826-05-0

5,6-Dibromoindoline-2,3-dione is a chemical compound that can be used as an anti-cancer drug. It has been shown to inhibit the activity of histone deacetylase enzymes in vitro and in vivo. 5,6-Dibromoindoline-2,3-dione has also been shown to have potential for use in cancer therapy by inhibiting tyrosine kinases and serotonin receptors. This compound is synthesized from indole and bromine. The chemical reactions involved are hydrogen bonding and substitution reactions.

Formula: C₈H₃Br₂NO₂

Purity: Min. 95%

Molecular weight: 304.93 g/mol

Ref: 3D-SAA82605