CAS 178268-91-2

4H-Pyrrolo[3,2-c]pyridin-4-one,1,5-dihydro-6-methyl-(9CI)

Description:

4H-Pyrrolo[3,2-c]pyridin-4-one, 1,5-dihydro-6-methyl- (CAS 178268-91-2) is a heterocyclic organic compound characterized by a fused pyrrole and pyridine ring system. This compound features a 4-one functional group, indicating the presence of a carbonyl group (C=O) within the pyrrole structure, contributing to its reactivity and potential biological activity. The "1,5-dihydro" designation suggests that the compound has two hydrogen atoms added to the ring, which can influence its stability and reactivity. The methyl group at the 6-position enhances its lipophilicity, potentially affecting its solubility and interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features allow for potential interactions with enzymes or receptors, which could be explored for therapeutic applications. Overall, 4H-Pyrrolo[3,2-c]pyridin-4-one represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-5-4-7-6(2-3-9-7)8(11)10-5/h2-4,9H,1H3,(H,10,11)

SMILES: Cc1cc2c(cc[nH]2)c(n1)O

Synonyms:

• 1,5-Dihydro-6-methyl-4H-pyrrolo[3,2-c]pyridin-4-one
• 6-methyl-1,5-dihydro-4H-pyrrolo[3,2-c]pyridin-4-one

4H-Pyrrolo[3,2-c]pyridin-4-one, 1,5-dihydro-6-methyl-

CAS: 178268-91-2

Formula: C₈H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA0025WH

1,5-Dihydro-6-methyl-4H-pyrrolo[3,2-c]pyridin-4-one

CAS: 178268-91-2

1,5-Dihydro-6-methyl-4H-pyrrolo[3,2-c]pyridin-4-one

Purity: 95%

Color and Shape: Powder

Molecular weight: 148.16g/mol

Ref: 54-OR15988

6-methyl-1H,4H,5H-pyrrolo[3,2-c]pyridin-4-one

CAS: 178268-91-2

Purity: 98%

Molecular weight: 148.1649933

Ref: 10-F771139