CAS 17829-82-2: Acetic acid, cerium(3+) salt, hydrate (2:3)

Description:Acetic acid, cerium(3+) salt, hydrate (2:3), with the CAS number 17829-82-2, is a coordination compound formed from cerium ions and acetic acid. This substance typically appears as a crystalline solid and is characterized by its solubility in water, which is influenced by the presence of the hydrate. The cerium ion in this compound exhibits a +3 oxidation state, which is common for lanthanide elements, and contributes to the compound's unique chemical properties, including its potential use in catalysis and materials science. The presence of acetic acid as a ligand can affect the stability and reactivity of the cerium ion, making it useful in various applications, including organic synthesis and as a precursor in the preparation of cerium oxide nanoparticles. Additionally, the hydrated form indicates that water molecules are integrated into the crystal structure, which can influence the compound's thermal stability and reactivity. Overall, this compound exemplifies the interplay between metal ions and organic ligands in coordination chemistry.

Formula:C₂H₄O₂CeH₂O

InChI:InChI=1S/C2H4O2.Ce.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2

InChI key:InChIKey=OKGRYXNRUMZNDO-UHFFFAOYSA-N

SMILES:[Ce].O=C(O)C.O

Synonyms:
Acetic acid, cerium(3+) salt, hydrate (2:3)
Acetic acid, cerium(3+) salt, sesquihydrate
Aceticacid,Cerium(3+)Salt,Hydrate(2:3)
Aceticacid,Cerium(3+)Salt,Sesquihydrate
Cerium Acetate Hydrate
Cerium acetate, sesquihydrate
Cerium triacetate sesquihydrate
Cerium(+3)Acetate Monohydrate
Cerium(3+) Acetate Hydrate (1:3:2)
Cerium(3+) Triacetate
See more synonyms
Cerium(Iii) Acetate Monohydrate
Ceriumacetate,Sesquihydrate
Cerous Acetate Monohydrate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Cerium(III) acetate sesquihydrate REF: 54-IN1402CAS: 17829-82-2	99.99%	To inquire	Mon 14 Apr 25
	Cerium(III) acetate sesquihydrate REF: 3D-SAA82982CAS: 17829-82-2	Min. 95%	To inquire	Mon 02 Jun 25