CAS 178307-42-1
:Revaprazan Hydrochloride
Description:
Revaprazan Hydrochloride is a novel compound classified as a potassium-competitive acid blocker (P-CAB), primarily used for the treatment of acid-related gastrointestinal disorders. It functions by selectively inhibiting the gastric H+/K+-ATPase enzyme, which plays a crucial role in gastric acid secretion. This inhibition leads to a reduction in gastric acidity, making it beneficial for conditions such as gastroesophageal reflux disease (GERD) and peptic ulcers. Revaprazan Hydrochloride is characterized by its high potency and rapid onset of action compared to traditional proton pump inhibitors (PPIs). The compound is typically administered orally and exhibits good bioavailability. Its chemical structure includes a pyridine ring, contributing to its pharmacological properties. Additionally, Revaprazan Hydrochloride has been noted for its favorable safety profile, with a lower incidence of side effects commonly associated with long-term acid suppression therapies. As research continues, its potential applications in various gastrointestinal disorders are being explored, highlighting its significance in modern therapeutic regimens.
Formula:C22H24ClFN4
InChI:InChI=1/C22H23FN4.ClH/c1-14-15(2)24-22(25-19-10-8-18(23)9-11-19)26-21(14)27-13-12-17-6-4-5-7-20(17)16(27)3;/h4-11,16H,12-13H2,1-3H3,(H,24,25,26);1H
SMILES:Cc1c(C)nc(Nc2ccc(cc2)F)nc1N1CCc2ccccc2C1C.Cl
Synonyms:- 2-Pyrimidinamine, 4-(3,4-dihydro-1-methyl-2(1H)-isoquinolinyl)-N-(4-fluorophenyl)-5,6-dimethyl-, monohydrochloride
- N-(4-Fluorophenyl)-5,6-dimethyl-4-((1RS)-1-methyl-3,4-dihydroisoquinolin-2(1H)-yl)pyrimidin-2-amine monohydrochloride
- Revanex
- Sb 641257A
- Unii-4Dq6T10R64
- Yh 1885
- Yh1885
- N-(4-fluorophenyl)-4,5-dimethyl-6-(1-methyl-3,4-dihydroisoquinolin-2(1H)-yl)pyrimidin-2-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Revaprazan HCl
CAS:Formula:C22H23FN4·HClColor and Shape:White To Off-White SolidMolecular weight:362.45 36.46Revaprazan hydrochloride
CAS:Revaprazan hydrochloride (YH1885) is the hydrochloride salt form of a lipophilic, weak base with potassium-competitive acid blocking (P-CAB) activity.Formula:C22H24ClFN4Purity:99.62% - 99.91%Color and Shape:SolidMolecular weight:398.9Revaprazan hydrochloride
CAS:K+/H+ ATPase inhibitorFormula:C22H23FN4•HClPurity:Min. 95%Color and Shape:PowderMolecular weight:398.9 g/molRevaprazan HCl - Bio-X ™
CAS:Revaprazan is a proton pump inhibitor drug that is used for the treatment of GERD and other conditions related to an excess in stomach acid production. This drug works by inhibiting the proton pump in the stomach lining known as the H+/K+-ATPase, resulting in a reduction of stomach acid and relief of symptoms.Formula:C22H24ClFN4Purity:Min. 95%Color and Shape:PowderMolecular weight:398.9 g/molRevaprazan Hydrochloride
CAS:Controlled ProductFormula:C22H23FN4·ClHColor and Shape:NeatMolecular weight:398.904






