CAS 178316-77-3

4-Hydroxy-3-isoxazolecarboxylic acid

Description:

4-Hydroxy-3-isoxazolecarboxylic acid, with the CAS number 178316-77-3, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the isoxazole ring, contributing to its acidic properties. The presence of these functional groups suggests that it may exhibit both polar and hydrogen-bonding capabilities, influencing its solubility in polar solvents such as water. The compound is of interest in various fields, including medicinal chemistry and agricultural science, due to its potential biological activities. Its structural characteristics may allow it to interact with biological targets, making it a candidate for further research in drug development or as a biochemical tool. Additionally, the stability and reactivity of the compound can be influenced by environmental factors, which is important for its application in practical scenarios.

Formula: C₄H₃NO₄

InChI: InChI=1S/C4H3NO4/c6-2-1-9-5-3(2)4(7)8/h1,6H,(H,7,8)

InChI key: InChIKey=CGLGFQXJBUOAAP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(O)=CON1

Synonyms:

• 3-Isoxazolecarboxylic acid, 4-hydroxy-
• 4-Hydroxy-3-isoxazolecarboxylic acid

3-Isoxazolecarboxylic acid, 4-hydroxy-

CAS: 178316-77-3

Formula: C₄H₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 129.0709

Ref: IN-DA0025Y2

1-(4-Hydroxyisoxazole)-carboxylic Acid

Controlled Product

CAS: 178316-77-3

Applications 1-(4-Hydroxyisoxazole)-carboxylic Acid (cas# 178316-77-3) is a compound useful in organic synthesis.

Formula: C₄H₃NO₄

Color and Shape: Neat

Molecular weight: 129.07

Ref: TR-H943590