CAS 17833-53-3
:N-Methylaspartic acid
Description:
N-Methylaspartic acid is an amino acid derivative characterized by the presence of a methyl group attached to the nitrogen atom of aspartic acid. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. It is known for its role as a neurotransmitter and is involved in various biochemical pathways, particularly in the central nervous system. N-Methylaspartic acid can act as an agonist at certain glutamate receptors, influencing synaptic transmission and plasticity. The compound is typically a white crystalline solid, soluble in water, and exhibits a zwitterionic form at physiological pH, which contributes to its stability and reactivity in biological systems. Its chemical structure includes both carboxylic acid and amine functional groups, which are essential for its interactions in biochemical processes. Due to its unique properties, N-Methylaspartic acid is of interest in pharmacological research, particularly in studies related to neurodegenerative diseases and cognitive function.
Formula:C5H9NO4
InChI:InChI=1S/C5H9NO4/c1-6-3(5(9)10)2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=HOKKHZGPKSLGJE-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C(O)=O)NC
Synonyms:- (RS)-N-methyL-aspartic acid
- 2-(Methylamino)butanedioic acid
- 2-(Methylamino)succinic acid
- <span class="text-smallcaps">DL</span>-Aspartic acid, N-methyl-
- <span class="text-smallcaps">DL</span>-N-Methylaspartic acid
- Aspartic acid, N-methyl-
- Aspartic acid, N-methyl-, <span class="text-smallcaps">DL</span>-
- N-Methyl-<span class="text-smallcaps">DL</span>-aspartate
- N-Methyl-<span class="text-smallcaps">DL</span>-aspartic acid
- N-Methyl-DL-aspartic acid hydrate
- N-Methyl-Dl-Aspartic Acid
- N-methylaspartic acid
- Aspartic acid, N-methyl-, DL-
- DL-Aspartic acid, N-methyl-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
dl-2-Methylaminosuccinic acid
CAS:dl-2-Methylaminosuccinic acidPurity:98%Color and Shape:White SolidMolecular weight:147.13g/molN-Methyl-DL-aspartic acid
CAS:N-Methyl-DL-aspartic acid, a glutamate analogue and NMDA receptor agonist, is utilized in neurological disease research.Formula:C5H9NO4Purity:99.85%Color and Shape:SolidMolecular weight:147.13N-Methyl-DL-aspartic acid
CAS:N-Methyl-DL-aspartic acid (NMDA) is a pharmacological agent that binds to the glutamate receptor and increases the intracellular calcium concentration in cells. NMDA has been shown to cause neuronal death in mouse hippocampal cells, as well as rat striatal cells. It can also act as a messenger molecule and enhance growth factor production. NMDA binds to the N-methyl-D-aspartate receptor, which is located on the surface of neurons in the brain. This binding causes an influx of sodium ions into the cell, resulting in an increase in the intracellular calcium concentration. This increase leads to changes in cellular function, including increased growth factor production and neuronal death.Formula:C5H9NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:147.13 g/molN-Methyl-DL-aspartic acid
CAS:Formula:C5H9NO4Purity:98%Color and Shape:White to off-white powderMolecular weight:147.13




