CAS 17834-02-5
:6-HYDROXYWARFARIN
Description:
6-Hydroxywarfarin is a derivative of warfarin, a well-known anticoagulant used in the prevention and treatment of thromboembolic disorders. This compound is characterized by the presence of a hydroxyl group at the 6-position of the coumarin ring, which influences its pharmacological properties. It is typically a white to off-white crystalline solid, soluble in organic solvents and slightly soluble in water. The presence of the hydroxyl group enhances its polarity compared to warfarin, potentially affecting its interaction with biological systems and its metabolic pathways. 6-Hydroxywarfarin is primarily studied for its role as a metabolite of warfarin, providing insights into the drug's metabolism and the mechanisms underlying its anticoagulant effects. Additionally, it serves as a valuable tool in pharmacokinetic studies and can be used to investigate the effects of genetic variations in drug metabolism. As with other warfarin derivatives, caution is advised in handling due to its biological activity and potential effects on coagulation pathways.
Formula:C19H16O5
InChI:InChI=1/C19H16O5/c1-11(20)9-14(12-5-3-2-4-6-12)17-18(22)15-10-13(21)7-8-16(15)24-19(17)23/h2-8,10,14,21-22H,9H2,1H3
SMILES:CC(=O)CC(c1ccccc1)c1c(c2cc(ccc2oc1=O)O)O
Synonyms:- 3-(Alpha-Acetonylbenzyl)-4,6-Dihydrocoumarin
- 4-6-Dihydroxy-3-(3-Oxo-1-Phenylbutyl)-2H-1-Benzopyran-2-One
- 3-(Α-Acetonylbenzyl)-4,6-Dihydrocoumarin
- 3-(α-Acetonylbenzyl)-4,6-dihydrocoumarin, 4-6-Dihydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one
- 2,6-dihydroxy-3-(3-oxo-1-phenylbutyl)-4H-chromen-4-one
- 4,6-dihydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 7 products.
6-Hydroxy Warfarin
CAS:Formula:C19H16O5Color and Shape:White To Off-White SolidMolecular weight:324.336-Hydroxy Warfarin-d5
CAS:Formula:C19H11D5O5Color and Shape:White To Off-White SolidMolecular weight:329.366-hydroxy Warfarin
CAS:6-Hydroxywarfarin is a metabolite of (+)-warfarin and a weak vitamin K antagonist.Formula:C19H16O5Color and Shape:SolidMolecular weight:324.33





