CAS 17838-04-9
:3-[(2-methylpropanoyl)amino]phenyl propan-2-ylcarbamate
Description:
3-[(2-Methylpropanoyl)amino]phenyl propan-2-ylcarbamate, with the CAS number 17838-04-9, is a chemical compound that belongs to the class of carbamates. This substance features a phenyl ring substituted with an amino group that is further linked to a 2-methylpropanoyl moiety, indicating the presence of an amide functional group. The propan-2-ylcarbamate portion suggests that it has a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) attached to a nitrogen atom (N) that is also bonded to an alkyl or aryl group. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic alkyl chains and aromatic character. Its potential applications may include use in pharmaceuticals or agrochemicals, given the structural features that suggest biological activity. As with many carbamates, it may also exhibit specific reactivity patterns, particularly in relation to nucleophilic attack or hydrolysis, which are important in both synthetic and biological contexts.
Formula:C14H20N2O3
InChI:InChI=1/C14H20N2O3/c1-9(2)13(17)16-11-6-5-7-12(8-11)19-14(18)15-10(3)4/h5-10H,1-4H3,(H,15,18)(H,16,17)
Synonyms:- Carbamic acid, (1-methylethyl)-, 3-[(2-methyl-1-oxopropyl)amino]phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3'-Hydroxy-2-methylpropionanilide isopropylcarbamate
CAS:3'-Hydroxy-2-methylpropionanilide isopropylcarbamate is a bioactive chemical.Formula:C14H20N2O3Color and Shape:SolidMolecular weight:264.32
