CAS 178388-79-9

3-(1H-IMIDAZOL-2-YL)-PROPIONIC ACID

Description:

3-(1H-Imidazol-2-yl)-propionic acid is an organic compound characterized by its imidazole ring and propionic acid functional group. This compound features a five-membered aromatic heterocyclic structure, which contributes to its biological activity and potential applications in pharmaceuticals. The presence of the carboxylic acid group (-COOH) allows for acidic properties, making it soluble in polar solvents like water. The imidazole moiety can participate in hydrogen bonding and coordination with metal ions, enhancing its reactivity and interaction with biological targets. This compound is often studied for its role in biochemical pathways and may serve as a building block in the synthesis of more complex molecules. Its unique structure allows it to mimic certain amino acids, potentially influencing protein interactions. Overall, 3-(1H-imidazol-2-yl)-propionic acid is of interest in medicinal chemistry and biochemistry due to its structural features and functional properties.

Formula: C₆H₈N₂O₂

InChI: InChI=1/C6H8N2O2/c9-6(10)2-1-5-7-3-4-8-5/h3-4H,1-2H2,(H,7,8)(H,9,10)

SMILES: C(CC(=O)O)c1ncc[nH]1

Synonyms:

• 3-(2-Imidazolyl)Propionic Acid
• 3-(1H-imidazol-2-yl)propanoic acid

3-(1H-Imidazol-2-yl)propanoic acid hydrochloride

CAS: 178388-79-9

Formula: C₆H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.1399

Ref: IN-DA0025ZD

3-(1h-Imidazol-2-yl)propanoicacid

CAS: 178388-79-9

3-(1h-Imidazol-2-yl)propanoicacid

Purity: 98%

Molecular weight: 140.14g/mol

Ref: 54-OR1034030

3-(1H-Imidazol-2-yl)propanoic acid

CAS: 178388-79-9

Purity: 98%

Molecular weight: 140.14

Ref: 10-F792192

3-(2-Imidazolyl)propionic acid

CAS: 178388-79-9

3-(2-Imidazolyl)propionic acid is a synthetic, alkenoic acid that has inhibitory potency. It is expressed in the transporter proteins and shown to have an inhibitory effect on uptake. 3-(2-Imidazolyl)propionic acid inhibits transporters by binding to the imidazole ring and changing its conformation, which changes the molecule's shape and prevents it from transporting the GABA neurotransmitter. This compound also inhibits gaba transporter in rats. 3-(2-Imidazolyl)propionic acid can be synthesized from 2-imidazolone via a four-step pathway involving diazotization, acetylation, acylation, and hydrolysis.

Formula: C₆H₈N₂O₂

Purity: Min. 95%

Molecular weight: 140.14 g/mol

Ref: 3D-DHA38879