CAS 17839-66-6
:2-(prop-2-en-1-ylsulfanyl)benzoic acid
Description:
2-(Prop-2-en-1-ylsulfanyl)benzoic acid, also known by its CAS number 17839-66-6, is an organic compound characterized by the presence of both a benzoic acid moiety and a prop-2-en-1-ylsulfanyl group. This compound features a sulfur atom bonded to a propene group, which introduces a degree of unsaturation and reactivity due to the presence of the double bond. The benzoic acid portion contributes to its acidity and potential for hydrogen bonding, making it soluble in polar solvents. The presence of the sulfanyl group can also impart unique chemical properties, such as the ability to participate in nucleophilic reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and organic synthesis. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals, although specific applications would depend on further research into its reactivity and biological interactions. Overall, 2-(prop-2-en-1-ylsulfanyl)benzoic acid is a versatile compound with interesting chemical properties.
Formula:C10H10O2S
InChI:InChI=1/C10H10O2S/c1-2-7-13-9-6-4-3-5-8(9)10(11)12/h2-6H,1,7H2,(H,11,12)
SMILES:C=CCSc1ccccc1C(=O)O
Synonyms:- 2-(Allylsulfanyl)benzoic acid
- Benzoic Acid, 2-(2-Propen-1-Ylthio)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-(Prop-2-en-1-ylsulfanyl)benzoic acid
CAS:<p>2-(Prop-2-en-1-ylsulfanyl)benzoic acid is a phenyl group that has the ability to form a desorption molecule. It is light resistant and photopolymerizable, which means it can be used in the production of polymers. The alkylthio group on this molecule allows for transfer and gel permeation chromatography. 2-(Prop-2-en-1-ylsulfanyl)benzoic acid also has a vinylic group, which makes it hydrosilylation crosslinkable. This makes it an excellent candidate for copolymerization and hydrosilylation.</p>Formula:C10H10O2SPurity:Min. 95%Molecular weight:194.25 g/mol
