CymitQuimica logo

CAS 178396-19-5

:

Isoxazole, 3-(3-chloropropyl)-5-methyl- (9CI)

Description:
Isoxazole, 3-(3-chloropropyl)-5-methyl- (9CI) is a heterocyclic organic compound characterized by the presence of an isoxazole ring, which consists of a five-membered ring containing three carbon atoms, one nitrogen atom, and one oxygen atom. This compound features a 3-(3-chloropropyl) substituent, indicating the presence of a chloropropyl group attached to the isoxazole ring, which can influence its reactivity and biological activity. Additionally, the 5-methyl group contributes to the compound's overall structure and may affect its solubility and interaction with other molecules. Isoxazoles are known for their diverse applications in medicinal chemistry, often exhibiting pharmacological properties such as anti-inflammatory, antimicrobial, or anticonvulsant activities. The specific characteristics of this compound, including its melting point, boiling point, and solubility, would depend on its molecular structure and substituents. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H10ClNO
InChI:InChI=1S/C7H10ClNO/c1-6-5-7(9-10-6)3-2-4-8/h5H,2-4H2,1H3
InChI key:InChIKey=YCCLKPDXVJYSOP-UHFFFAOYSA-N
SMILES:C(CCCl)C=1C=C(C)ON1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 3-(3-Chloropropyl)-5-methylisoxazole

    Controlled Product
    CAS:

    Applications 3-(3-Chloropropyl)-5-methylisoxazole, is a building block used in chemical synthesis of more complex compounds.

    Formula:C7H10ClNO
    Color and Shape:Neat
    Molecular weight:159.613

    Ref: TR-C179230

    500mg
    1,530.00€