CAS 178396-31-1: 6-Bromo-8-methylquinoline
Description:6-Bromo-8-methylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a bromine atom at the 6-position and a methyl group at the 8-position of the quinoline structure, which influences its chemical reactivity and properties. It is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents. The presence of the bromine substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, quinoline derivatives are known for their biological activities, and 6-bromo-8-methylquinoline may exhibit antimicrobial or antitumor properties, although specific biological data would depend on empirical studies. Its applications may extend to pharmaceuticals, agrochemicals, and materials science, where its unique structural features can be exploited for the development of novel compounds. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C10H8BrN
InChI:InChI=1S/C10H8BrN/c1-7-5-9(11)6-8-3-2-4-12-10(7)8/h2-6H,1H3
InChI key:InChIKey=RYYKJLRAFMKRSC-UHFFFAOYSA-N
SMILES:BrC1=CC2=CC=CN=C2C(=C1)C
- Synonyms:
- 6-Bromo-8-Methylquinoline
- Quinoline, 6-bromo-8-methyl-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6-Bromo-8-methylquinoline REF: 10-F239078CAS: 178396-31-1 | 95.0% | 50.00 €~216.00 € | Mon 07 Apr 25 |
 | Quinoline, 6-bromo-8-methyl- REF: IN-DA0025Z6CAS: 178396-31-1 | 97% | To inquire | Mon 14 Apr 25 |
 | 6-Bromo-8-methylquinoline REF: 54-OR480792CAS: 178396-31-1 | 98+% | 32.00 €~1,184.00 € | Tue 15 Apr 25 |
 | 6-Bromo-8-methylquinoline REF: 3D-FB162443CAS: 178396-31-1 | Min. 95% | - - - | Discontinued product |
6-Bromo-8-methylquinoline
Ref: 10-F239078
| 1g | 50.00 € | ||
| 5g | 216.00 € |
Quinoline, 6-bromo-8-methyl-
Ref: IN-DA0025Z6
| 1g | 81.00 € | ||
| 5g | 225.00 € | ||
| 250mg | 36.00 € |
6-Bromo-8-methylquinoline
Ref: 54-OR480792
| 1g | 61.00 € | ||
| 5g | 265.00 € | ||
| 25g | 1,184.00 € | ||
| 250mg | 32.00 € |
6-Bromo-8-methylquinoline
Ref: 3D-FB162443
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
