CAS 17841-68-8

Methyl 3-(aminomethyl)benzoate hydrochloride

Description:

Methyl 3-(aminomethyl)benzoate hydrochloride, with the CAS number 17841-68-8, is a chemical compound that belongs to the class of benzoate esters. It is characterized by the presence of a methyl ester group and an aminomethyl substituent on the benzene ring, which contributes to its potential biological activity. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. Methyl 3-(aminomethyl)benzoate hydrochloride may be utilized in pharmaceutical research, particularly in the synthesis of biologically active molecules or as an intermediate in organic synthesis. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-5H,6,10H2,1H3

SMILES: COC(=O)c1cccc(c1)CN

Synonyms:

• 3-AminomethylbenzoicacidmethylesterHCl
• 3-Aminomethyl-benzoic acid methyl ester hydrochloride

Benzoic acid, 3-(aminomethyl)-, methyl ester, hydrochloride (1:1)

CAS: 17841-68-8

Formula: C₉H₁₂ClNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 201.6501

Ref: IN-DA002613

Methyl 3-(aminomethyl)benzoate hydrochloride

CAS: 17841-68-8

Methyl 3-(aminomethyl)benzoate hydrochloride

Formula: C₉H₁₁NO₂·ClH

Purity: 99%

Color and Shape: white powder

Molecular weight: 201.65g/mol

Ref: 54-OR7914

Methyl 3-(aminomethyl)benzoate hydrochloride

CAS: 17841-68-8

Formula: C₉H₁₂ClNO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 201.65

Ref: 10-F023467

(3-Aminomethyl)benzoic acid methyl ester HCl

CAS: 17841-68-8

3-Aminomethylbenzoic acid methyl ester HCl is a fine chemical that is used as a reagent for the synthesis of other compounds. It is also a versatile building block, which can be used to make many different compounds. 3-Aminomethylbenzoic acid methyl ester HCl has been demonstrated to be a useful intermediate in the synthesis of various pharmaceuticals, such as metoclopramide and clozapine. 3-Aminomethylbenzoic acid methyl ester HCl is also a useful scaffold for research chemicals, such as 4-amino-N-(2-hydroxyethyl)benzenesulfonamide or N-[3-(aminomethyl)phenyl]acetamide.

Formula: C₉H₁₁NO₂·HCl

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 201.65 g/mol

Ref: 3D-FM11569