CAS 178488-39-6

5-Methylimidazo[1,2-a]pyridine-3-methanol

Description:

5-Methylimidazo[1,2-a]pyridine-3-methanol is a chemical compound that belongs to the class of heterocyclic organic compounds, specifically imidazo-pyridines. It features a fused ring structure that includes both imidazole and pyridine moieties, which contribute to its unique chemical properties. The presence of a methyl group at the 5-position and a hydroxymethyl group at the 3-position enhances its reactivity and solubility in various solvents. This compound is of interest in the field of medicinal chemistry and toxicology, as it may exhibit biological activity and has been studied for its potential role in mutagenesis and carcinogenesis. Its molecular structure allows for various interactions with biological macromolecules, which can influence its pharmacological effects. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions, making it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₉H₁₀N₂O

InChI: InChI=1S/C9H10N2O/c1-7-3-2-4-9-10-5-8(6-12)11(7)9/h2-5,12H,6H2,1H3

InChI key: InChIKey=MVDFZQQVFPAFCJ-UHFFFAOYSA-N

SMILES: C(O)C=1N2C(=NC1)C=CC=C2C

Synonyms:

• Imidazo[1,2-a]pyridine-3-methanol, 5-methyl-
• 5-Methylimidazo[1,2-a]pyridine-3-methanol

Imidazo[1,2-a]pyridine-3-methanol, 5-methyl-

CAS: 178488-39-6

Formula: C₉H₁₀N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 162.1885

Ref: IN-DA00262P

(5-Methylimidazo[1,2-a]pyridin-3-yl)methanol

CAS: 178488-39-6

(5-Methylimidazo[1,2-a]pyridin-3-yl)methanol

Purity: 95%

Molecular weight: 162.19g/mol

Ref: 54-OR943823

(5-methylimidazo[1,2-a]pyridin-3-yl)methanol

CAS: 178488-39-6

Formula: C₉H₁₀N₂O

Purity: 95.0%

Molecular weight: 162.192

Ref: 10-F310313