CAS 17849-62-6

(2R)-2-chloro-3-phenylpropanenitrile

Description:

(2R)-2-chloro-3-phenylpropanenitrile, with the CAS number 17849-62-6, is an organic compound characterized by its structural features, which include a chloro group and a nitrile functional group attached to a propyl chain that is further substituted with a phenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the nitrile group, which can participate in various chemical reactions, including nucleophilic additions and hydrolysis. The chloro substituent can also influence its reactivity, making it a potential intermediate in organic synthesis. The stereochemistry indicated by the (2R) designation suggests that the compound has a specific three-dimensional arrangement, which can affect its biological activity and interactions with other molecules. Safety precautions should be taken when handling this compound, as it may pose health risks, including toxicity and irritant properties.

Formula: C₉H₈ClN

InChI: InChI=1/C9H8ClN/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,9H,6H2/t9-/m1/s1

SMILES: c1ccc(cc1)C[C@H](C#N)Cl

2-Chloro-3-phenylpropanenitrile

CAS: 17849-62-6

Formula: C₉H₈ClN

Molecular weight: 165.6195

Ref: IN-DA00263E

2-Chloro-3-phenylpropionitrile

CAS: 17849-62-6

2-Chloro-3-phenylpropionitrile

Purity: 95%

Molecular weight: 165.62g/mol

Ref: 54-OR346453

2-Chloro-3-phenyl-propionitrile

CAS: 17849-62-6

Formula: C₉H₈ClN

Purity: 95.0%

Color and Shape: Liquid, Oil

Molecular weight: 165.62

Ref: 10-F317427

2-Chloro-3-phenylpropanenitrile

CAS: 17849-62-6

Versatile small molecule scaffold

Formula: C₉H₈ClN

Purity: Min. 95%

Molecular weight: 165.62 g/mol

Ref: 3D-SAA84962