CymitQuimica logo

CAS 178550-61-3

:

L-Alanine, N-(cyclohexylcarbonyl)-, (5R,6E,8E,10E,13S,14R,15R,16Z)-15,21-dihydroxy-5-methoxy-14,16-dimethyl-3,22,24-trioxo-2-azabicyclo[18.3.1]tetracosa-6,8,10,16,20,23-hexaen-13-yl ester

Description:
L-Alanine, N-(cyclohexylcarbonyl)-, with the CAS number 178550-61-3, is a complex organic compound characterized by its unique bicyclic structure and multiple functional groups. This substance features a bicyclo[18.3.1] framework, which contributes to its rigidity and potential biological activity. The presence of multiple hydroxyl (-OH) groups indicates that it may exhibit hydrophilic properties, enhancing its solubility in polar solvents. The methoxy (-OCH3) and carbonyl (C=O) groups suggest potential reactivity and interactions with other molecules, making it of interest in medicinal chemistry. The stereochemistry, indicated by the specific R and S configurations, is crucial for its biological activity, as the spatial arrangement of atoms can significantly influence how the compound interacts with biological targets. Additionally, the presence of multiple double bonds (indicated by the "hexaen" nomenclature) may impart unique electronic properties, potentially affecting its reactivity and stability. Overall, this compound's intricate structure and functional diversity suggest potential applications in pharmaceuticals or biochemistry.
Formula:C36H48N2O9
InChI:InChI=1/C36H48N2O9/c1-22-14-13-18-27-33(42)28(21-29(39)34(27)43)38-31(40)20-26(46-4)17-11-6-5-7-12-19-30(23(2)32(22)41)47-36(45)24(3)37-35(44)25-15-9-8-10-16-25/h5-7,11-12,14,17,21,23-26,30,32,41-42H,8-10,13,15-16,18-20H2,1-4H3,(H,37,44)(H,38,40)/b6-5+,12-7-,17-11+,22-14-/t23?,24-,26?,30?,32?/m1/s1
Synonyms:
  • L-Alanine, N-(cyclohexylcarbonyl)-, (5R,6E,8E,10E,13S,14R,15R,16Z)-15,21-dihydroxy-5-methoxy-14,16-dimethyl-3,22,24-trioxo-2-azabicyclo[18.3.1]tetracosa-6,8,10,16,20,23-hexaen-13-yl ester
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Hydroxymycotrienin A

    CAS:
    <p>Hydroxymycotrienin A is an ansamycin antibiotic with the ability to inhibit human neck tumor cell lines. Its inhibitory effect is more pronounced on HPV-positive neck tumor cells (such as HeLa, CaSKi, and SiHa) compared to HPV-negative cells.</p>
    Formula:C36H48N2O9
    Color and Shape:Solid
    Molecular weight:652.774