CAS 17857-70-4

tributyl(cyclopropyl)stannane

Description:

Tributyl(cyclopropyl)stannane, with the CAS number 17857-70-4, is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and one cyclopropyl group. This compound typically exhibits a colorless to pale yellow liquid form and is known for its relatively low volatility. Organotin compounds like tributyl(cyclopropyl)stannane are often utilized in various applications, including as intermediates in organic synthesis and as stabilizers in polymer formulations. The presence of the cyclopropyl group can impart unique reactivity and steric properties, making it valuable in synthetic chemistry. Additionally, organotin compounds are subject to environmental regulations due to their potential toxicity and bioaccumulation in aquatic systems. As with many organotin compounds, careful handling and disposal are essential to mitigate environmental impact and health risks. Overall, tributyl(cyclopropyl)stannane serves as an important compound in the field of organometallic chemistry, with applications that leverage its distinctive structural features.

Formula: C₁₅H₃₂Sn

InChI: InChI=1/3C4H9.C3H5.Sn/c3*1-3-4-2;1-2-3-1;/h3*1,3-4H2,2H3;1H,2-3H2;/rC15H32Sn/c1-4-7-12-16(13-8-5-2,14-9-6-3)15-10-11-15/h15H,4-14H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)C1CC1

Synonyms:

• Stannane, tributylcyclopropyl-
• Tributyl(cyclopropyl)stannane

Stannane, tributylcyclopropyl-

CAS: 17857-70-4

Formula: C₁₅H₃₂Sn

Purity: 97%

Color and Shape: Liquid

Molecular weight: 331.1156

Ref: IN-DA00265U