CAS 1785761-02-5

2-[5-[(3-Chlorophenyl)methyl]-2-oxazolyl]piperidine

Description:

2-[5-[(3-Chlorophenyl)methyl]-2-oxazolyl]piperidine is a chemical compound characterized by its unique structural features, which include a piperidine ring and an oxazole moiety. The presence of a 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. This compound is likely to be a solid at room temperature, given the typical characteristics of similar organic compounds. Its molecular structure suggests it may engage in hydrogen bonding due to the nitrogen atoms in the piperidine and oxazole rings, influencing its solubility and reactivity. The oxazole ring can also participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development. Additionally, the presence of the chlorophenyl group may enhance lipophilicity, affecting its distribution in biological systems. Overall, 2-[5-[(3-Chlorophenyl)methyl]-2-oxazolyl]piperidine represents a complex organic molecule with potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₅H₁₇ClN₂O

InChI: InChI=1S/C15H17ClN2O/c16-12-5-3-4-11(8-12)9-13-10-18-15(19-13)14-6-1-2-7-17-14/h3-5,8,10,14,17H,1-2,6-7,9H2

InChI key: InChIKey=LJSQCUJIFSBJLP-UHFFFAOYSA-N

SMILES: C(C=1OC(=NC1)C2CCCCN2)C3=CC(Cl)=CC=C3

Synonyms:

• Piperidine, 2-[5-[(3-chlorophenyl)methyl]-2-oxazolyl]-
• 2-[5-[(3-Chlorophenyl)methyl]-2-oxazolyl]piperidine