CymitQuimica logo

CAS 1785761-76-3

:

9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol

Description:
9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom and an oxygen atom within its framework. The compound features a phenylmethyl group, contributing to its aromatic properties and potentially influencing its reactivity and interactions. The presence of the oxa and aza atoms indicates that it belongs to a class of compounds known as heterocycles, which often exhibit diverse biological activities. The spiro structure suggests that the compound may have interesting conformational properties, which can affect its pharmacological profile. Additionally, the hydroxyl group (-OH) at the 4-position may enhance its solubility in polar solvents and could play a role in hydrogen bonding interactions. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C16H23NO2
InChI:InChI=1S/C16H23NO2/c18-15-6-11-19-16(12-15)7-9-17(10-8-16)13-14-4-2-1-3-5-14/h1-5,15,18H,6-13H2
InChI key:InChIKey=RLLPUQHBPAGCBP-UHFFFAOYSA-N
SMILES:OC1CC2(CCN(CC3=CC=CC=C3)CC2)OCC1
Synonyms:
  • 9-Benzyl-1-oxa-9-azaspiro[5.5]undecan-4-ol
  • 9-(Phenylmethyl)-1-oxa-9-azaspiro[5.5]undecan-4-ol
  • 1-Oxa-9-azaspiro[5.5]undecan-4-ol, 9-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.