CAS 1786-27-2

1,4-Benzenediol, compd. with sulfur dioxide (1:?)

Description:

The chemical substance known as "1,4-Benzenediol, compd. with sulfur dioxide (1:?)" with the CAS number 1786-27-2 is a complex formed between 1,4-benzenediol (also known as p-hydroxyphenol) and sulfur dioxide. 1,4-Benzenediol is an aromatic compound characterized by two hydroxyl groups (-OH) attached to a benzene ring at the 1 and 4 positions, which imparts properties such as solubility in water and the ability to participate in various chemical reactions, including oxidation and polymerization. The presence of sulfur dioxide suggests that this compound may exhibit unique reactivity or stability due to the interaction between the aromatic hydroxyl groups and the sulfur dioxide, potentially influencing its applications in organic synthesis or as a reducing agent. This compound may also have implications in environmental chemistry, particularly in the context of air pollution and the behavior of sulfur dioxide in the atmosphere. However, specific applications and detailed properties would require further investigation into its behavior and interactions in various chemical contexts.

Formula: C₆H₆O₂·xO₂S

InChI: InChI=1S/C6H6O2.O2S/c7-5-1-2-6(8)4-3-5;1-3-2/h1-4,7-8H;

InChI key: InChIKey=ZGUVVJOTWDTXFR-UHFFFAOYSA-N

SMILES: S(=O)=O.OC1=CC=C(O)C=C1

Synonyms:

• 1,4-Benzenediol, compd. with sulfur dioxide
• Sulfur dioxide, compd. with hydroquinone
• 1,4-Benzenediol, compd. with sulfur dioxide (1:?)
• Hydroquinone, compd. with sulfur dioxide
• Sulfur dioxide, compd. with 1,4-benzenediol

1,4-Benzenediol, compd. with sulfur dioxide (1:?)

CAS: 1786-27-2

Formula: C₆H₆O₄S

Molecular weight: 174.1744

Ref: IN-DA00266F