CAS 17861-60-8
:3-Ethyl-1,1,1,3,5,5,5-heptamethyltrisiloxane
Description:
3-Ethyl-1,1,1,3,5,5,5-heptamethyltrisiloxane, with the CAS number 17861-60-8, is a siloxane compound characterized by its unique siloxane backbone, which consists of silicon-oxygen bonds. This compound features a branched structure with three silicon atoms and multiple methyl groups, contributing to its hydrophobic properties and thermal stability. The presence of an ethyl group enhances its solubility in organic solvents and may influence its reactivity and interaction with other substances. Typically, siloxanes like this one exhibit low volatility, making them useful in various applications, including as lubricants, surfactants, and in cosmetic formulations due to their smooth texture and skin-conditioning properties. Additionally, they are known for their resistance to moisture and temperature variations, which can be advantageous in industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 3-Ethyl-1,1,1,3,5,5,5-heptamethyltrisiloxane is valued for its unique chemical properties and versatility in various fields.
Formula:C9H26O2Si3
InChI:InChI=1S/C9H26O2Si3/c1-9-14(8,10-12(2,3)4)11-13(5,6)7/h9H2,1-8H3
InChI key:InChIKey=HLPWCQDWRYCGLK-UHFFFAOYSA-N
SMILES:[Si](O[Si](C)(C)C)(O[Si](C)(C)C)(CC)C
Synonyms:- 3-Ethylheptamethyltrisiloxane
- Silsoft ETS
- Silsoft ETS Trisiloxane
- Trisiloxane, 3-ethyl-1,1,1,3,5,5,5-heptamethyl-
- 3-Ethyl-1,1,1,3,5,5,5-heptamethyltrisiloxane
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery