
CAS 17863-69-3
:1,2-Didecanoylglycerol
Description:
1,2-Didecanoylglycerol, with the CAS number 17863-69-3, is a synthetic glycerolipid characterized by its structure, which consists of a glycerol backbone esterified with two decanoyl (capric acid) fatty acid chains at the first and second positions. This compound is a type of diacylglycerol (DAG) and is notable for its role in various biological processes, including cell signaling and lipid metabolism. It is typically a colorless to pale yellow liquid and is soluble in organic solvents but has limited solubility in water due to its hydrophobic fatty acid chains. 1,2-Didecanoylglycerol is often used in biochemical research to study lipid signaling pathways and the effects of diacylglycerols on cellular functions. Its properties, such as melting point and boiling point, can vary based on purity and environmental conditions. As a lipid, it plays a crucial role in membrane dynamics and can influence cellular processes such as proliferation and differentiation.
Formula:C23H44O5
InChI:InChI=1S/C23H44O5/c1-3-5-7-9-11-13-15-17-22(25)27-20-21(19-24)28-23(26)18-16-14-12-10-8-6-4-2/h21,24H,3-20H2,1-2H3
InChI key:InChIKey=GNSDEDOVXZDMKM-UHFFFAOYSA-N
SMILES:C(COC(CCCCCCCCC)=O)(OC(CCCCCCCCC)=O)CO
Synonyms:- Glycerol 1,2-didecanoate
- Decanoin, 1,2-di-
- Decanoic acid, 1,1′-[1-(hydroxymethyl)-1,2-ethanediyl] ester
- Capric diglyceride
- Decanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Decanoic acid, 1,1'-[1-(hydroxymethyl)-1,2-ethanediyl] ester
CAS:Formula:C23H44O5Molecular weight:400.5925(±)1,2-Didecanoylglycerol
CAS:The lipid 1,2-didecanoylglycerol (1,2-DG) is a substrate molecule for lipolytic enzymes and has been shown to inhibit the activation of these enzymes by binding to the enzyme's active site. It also has inhibitory properties against ATP sensitive K+ channels and intracellular Ca2+ levels. The phase transition temperature for 1,2-DG is higher than that of other phospholipids, which may be responsible for its inhibition of the enzyme activity. Additional studies are needed to determine the clinical relevance of 1,2-DG in humans.Formula:C23H44O5Purity:Min. 95%Color and Shape:Clear Viscous LiquidMolecular weight:400.6 g/mol1,2-Didecanoylglycerol
CAS:1,2-Didecanoylglycerol has functions as bioregulator of protein kinase C in human platelets.Formula:C23H44O5Color and Shape:SolidMolecular weight:400.59



