CAS 178671-73-3: N-[(Formylamino)iminomethyl]urea

Description:N-[(Formylamino)iminomethyl]urea, with the CAS number 178671-73-3, is a chemical compound characterized by its unique functional groups, which include an amine, an imine, and a urea moiety. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of multiple hydrogen bond donors and acceptors. Its structure suggests potential reactivity, particularly in forming coordination complexes or participating in condensation reactions. The presence of the formylamino group indicates that it may engage in further chemical transformations, such as nucleophilic attacks or polymerization. N-[(Formylamino)iminomethyl]urea may have applications in medicinal chemistry or materials science, although specific uses would depend on its reactivity and stability under various conditions. As with many nitrogen-containing compounds, it may exhibit biological activity, warranting further investigation into its pharmacological properties. Safety data should be consulted before handling, as with any chemical substance, to ensure proper precautions are taken.

Formula:C₃H₆N₄O₂

InChI:InChI=1S/C3H6N4O2/c4-2(6-1-8)7-3(5)9/h1H,(H5,4,5,6,7,8,9)

InChI key:InChIKey=PMGSUDGTDUFWCI-UHFFFAOYSA-N

SMILES:O=CNC(=N)NC(=O)N