CAS 17869-31-7
:Dichloromethyl(2,4,4-trimethylpentyl)silane
Description:
Dichloromethyl(2,4,4-trimethylpentyl)silane, with the CAS number 17869-31-7, is an organosilicon compound characterized by the presence of a silicon atom bonded to both chlorine and organic groups. This compound typically exhibits a silane structure, where the silicon atom is connected to a dichloromethyl group and a branched alkyl chain, specifically 2,4,4-trimethylpentyl. The presence of chlorine atoms imparts certain reactivity, making it useful in various chemical applications, including as a coupling agent or in the synthesis of siloxane polymers. Its branched alkyl chain contributes to its hydrophobic properties, influencing its solubility and interaction with other substances. Dichloromethyl(2,4,4-trimethylpentyl)silane is generally handled with care due to its potential reactivity and the health hazards associated with chlorine-containing compounds. As with many organosilicon compounds, it may be used in the development of coatings, adhesives, and sealants, benefiting from its unique chemical properties. Proper safety measures should be observed when working with this substance to mitigate any risks associated with exposure.
Formula:C9H20Cl2Si
InChI:InChI=1S/C9H20Cl2Si/c1-8(6-9(2,3)4)7-12(5,10)11/h8H,6-7H2,1-5H3
InChI key:InChIKey=ZBQAZUXZJUGVOY-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)C(C[Si](C)(Cl)Cl)C
Synonyms:- Dichloromethyl(2,4,4-trimethylpentyl)silane
- (2,4,4-Trimethylpentyl)methyldichlorosilane
- Silane, dichloromethyl(2,4,4-trimethylpentyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
