CymitQuimica logo

CAS 178758-80-0

:

3-(5-Amino-1-pentanoyl)pyridine Dihydrochloride

Description:
3-(5-Amino-1-pentanoyl)pyridine dihydrochloride is a chemical compound characterized by its pyridine ring structure, which is substituted with a 5-amino-1-pentanoyl group. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility through ionic interactions. The presence of the amino group suggests potential for biological activity, possibly as a pharmaceutical agent or in biochemical applications. The dihydrochloride form indicates that the compound has two hydrochloride ions associated with it, which can influence its stability and reactivity. In terms of safety, like many amine-containing compounds, it may require careful handling due to potential irritant properties. Overall, this compound's unique structure and properties make it of interest in various fields, including medicinal chemistry and drug development.
Formula:C10H16Cl2N2O
InChI:InChI=1/C10H14N2O.2ClH/c11-6-2-1-5-10(13)9-4-3-7-12-8-9;;/h3-4,7-8H,1-2,5-6,11H2;2*1H
SMILES:C(CCN)CC(=O)c1cccnc1.Cl.Cl
Synonyms:
  • 5-Amino-1-(3-pyridinyl)-1-pentanone Dihydrochloride
  • 5-Amino-1-Pyridin-3-Ylpentan-1-One Dihydrochloride
  • 3-(5-Aminopentanoyl)pyridine dihydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.