CAS 178764-92-6

1,2,3,5-Tetrahydro-2,2,5,5,7-pentamethyl-6H-pyrrolo[3,2-b]pyridin-6-one

Description:

1,2,3,5-Tetrahydro-2,2,5,5,7-pentamethyl-6H-pyrrolo[3,2-b]pyridin-6-one, with CAS number 178764-92-6, is a heterocyclic organic compound characterized by its complex bicyclic structure that includes both pyrrole and pyridine moieties. This compound features a tetrahydro framework, indicating that it contains a saturated ring system, which contributes to its stability and reactivity. The presence of multiple methyl groups enhances its lipophilicity, potentially influencing its solubility and biological activity. The compound's unique structure may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Additionally, its synthesis and characterization are significant for understanding its potential applications in various fields, including organic synthesis and materials science. As with many heterocycles, the electronic properties and steric factors associated with the substituents can affect its reactivity and interactions with biological targets. Overall, this compound exemplifies the diversity and complexity found in organic chemistry, particularly within the realm of nitrogen-containing heterocycles.

Formula: C₁₂H₁₈N₂O

InChI: InChI=1S/C12H18N2O/c1-7-9-8(6-11(2,3)14-9)13-12(4,5)10(7)15/h14H,6H2,1-5H3

InChI key: InChIKey=OTBGQBSPIWKINO-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(C)(C)C1=O)CC(C)(C)N2

Synonyms:

• Agrocybenine
• 6H-Pyrrolo[3,2-b]pyridin-6-one, 1,2,3,5-tetrahydro-2,2,5,5,7-pentamethyl-
• 1,2,3,5-Tetrahydro-2,2,5,5,7-pentamethyl-6H-pyrrolo[3,2-b]pyridin-6-one
• 2,2,5,5,7-Pentamethyl-1H,2H,3H,5H,6H-pyrrolo[3,2-b]pyridin-6-one

Agrocybenine

CAS: 178764-92-6

Agrocybenine is a natural product of Alstonia, Apocynaceae.

Formula: C₁₂H₁₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 206.28

Ref: TM-TN3365

Agrocybenine

CAS: 178764-92-6

Formula: C₁₂H₁₈N₂O

Purity: 95%~99%

Color and Shape: Yellow Powder

Molecular weight: 206.289

Ref: BP-SBP02554

Agrocybenine

CAS: 178764-92-6

Agrocybenine is a bioactive compound that serves as a natural antifungal agent, primarily derived from certain species of mushrooms, notably within the genus Agrocybe. This compound exerts its effects by disrupting fungal cell wall synthesis, thereby inhibiting the growth and proliferation of pathogenic fungi. Agrocybenine's mechanism of action is especially effective against fungi by interfering with essential biosynthetic processes, highlighting its potential use as a natural fungicide.

Formula: C₁₂H₁₈N₂O

Purity: Min. 95%

Molecular weight: 206.28 g/mol

Ref: 3D-DHA76492