CAS 178765-55-4

4-[(1E,3S)-3-Ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadien-1-yl]phenol

Description:

4-[(1E,3S)-3-Ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadien-1-yl]phenol, with the CAS number 178765-55-4, is a chemical compound characterized by its complex structure that includes a phenolic group and a long hydrocarbon chain featuring multiple double bonds. This compound is likely to exhibit properties typical of phenols, such as being a weak acid and having the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) group. The presence of the ethenyl and dimethyl groups suggests that it may have significant hydrophobic characteristics, influencing its solubility in organic solvents rather than water. Additionally, the conjugated double bonds in the hydrocarbon chain may contribute to its reactivity and potential biological activity, possibly acting as a natural product or a derivative of a plant metabolite. Its structural complexity may also indicate potential applications in fields such as pharmaceuticals, agrochemicals, or as a biochemical probe, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₈H₂₄O₂

InChI: InChI=1S/C18H24O2/c1-5-18(4,13-11-17(20)14(2)3)12-10-15-6-8-16(19)9-7-15/h5-10,12,17,19-20H,1-2,11,13H2,3-4H3/b12-10+/t17?,18-/m0/s1

InChI key: InChIKey=GWTVXRIOJRNDCM-UGFQGZRZSA-N

SMILES: [C@@](/C=C/C1=CC=C(O)C=C1)(CCC(C(C)=C)O)(C=C)C

Synonyms:

• Phenol, 4-[(1E,3S)-3-ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadien-1-yl]-
• Phenol, 4-[(1E,3S)-3-ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadienyl]-
• 4-[(1E,3S)-3-Ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadien-1-yl]phenol
• Phenol, 4-(3-ethenyl-6-hydroxy-3,7-dimethyl-1,7-octadienyl)-
• Δ1,3-Hydroxybakuchiol

12-Hydroxyisobakuchiol

CAS: 178765-55-4

Formula: C₁₈H₂₄O₂

Molecular weight: 272.3820

Ref: IN-DA0026AR

12-Hydroxyisobakuchiol

CAS: 178765-55-4

12-Hydroxyisobakuchiol is a biochemical compound, which is sourced from plant origins, specifically related to species within the Fabaceae family. It acts through modulating cellular pathways involved in anti-aging and anti-inflammatory responses, exhibiting potential interactions at the molecular level with skin cell receptors and enzymes that regulate dermal matrix components.

Formula: C₁₈H₂₄O₂

Purity: Min. 95%

Molecular weight: 272.40 g/mol

Ref: 3D-DHA76555